| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 15:09:46 UTC |
|---|
| Update Date | 2025-03-25 00:57:18 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02223955 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C16H22N2O4 |
|---|
| Molecular Mass | 306.158 |
|---|
| SMILES | NC(=O)Cc1ccc(OCC(O)CN2CCC(=O)CC2)cc1 |
|---|
| InChI Key | PSISGXVKHQDDRB-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | benzenoids |
|---|
| Class | benzene and substituted derivatives |
|---|
| Subclass | phenylacetamides |
|---|
| Direct Parent | phenylacetamides |
|---|
| Geometric Descriptor | aromatic heteromonocyclic compounds |
|---|
| Alternative Parents | 1,2-aminoalcoholsalkyl aryl ethersamino acids and derivativesazacyclic compoundscarboxylic acids and derivativescyclic ketoneshydrocarbon derivativesorganic oxidesorganopnictogen compoundsphenol ethersphenoxy compoundspiperidinonesprimary carboxylic acid amidessecondary alcoholstrialkylamines |
|---|
| Substituents | primary carboxylic acid amidephenol ethercarbonyl groupetheraromatic heteromonocyclic compoundamino acid or derivativescyclic ketonealkyl aryl ethercarboxylic acid derivativeketoneorganic oxideorganonitrogen compoundorganopnictogen compoundpiperidinonepiperidinephenylacetamidetertiary amineorganoheterocyclic compoundalcoholazacycle1,2-aminoalcoholtertiary aliphatic aminecarboxamide grouporganic oxygen compoundsecondary alcoholhydrocarbon derivativeorganic nitrogen compoundphenoxy compoundamineorganooxygen compound |
|---|
