| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 15:09:47 UTC |
|---|
| Update Date | 2025-03-25 00:57:19 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02223958 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C11H15NO3S |
|---|
| Molecular Mass | 241.0773 |
|---|
| SMILES | NC(=O)Cc1ccc(OCC(O)CS)cc1 |
|---|
| InChI Key | UGUJNNOXDXKVOM-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | benzenoids |
|---|
| Class | benzene and substituted derivatives |
|---|
| Subclass | phenylacetamides |
|---|
| Direct Parent | phenylacetamides |
|---|
| Geometric Descriptor | aromatic homomonocyclic compounds |
|---|
| Alternative Parents | alkyl aryl ethersalkylthiolscarbonyl compoundscarboxylic acids and derivativeshydrocarbon derivativesorganic oxidesorganonitrogen compoundsorganopnictogen compoundsorganosulfur compoundsphenol ethersphenoxy compoundsprimary carboxylic acid amidessecondary alcohols |
|---|
| Substituents | primary carboxylic acid amidealcoholphenol ethercarbonyl groupetheralkyl aryl etherorganosulfur compoundcarboxamide groupcarboxylic acid derivativearomatic homomonocyclic compoundorganic oxideorganic oxygen compoundorganonitrogen compoundsecondary alcoholorganopnictogen compoundhydrocarbon derivativeorganic nitrogen compoundphenoxy compoundphenylacetamidealkylthiolorganooxygen compound |
|---|