| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 15:09:47 UTC |
|---|
| Update Date | 2025-03-25 00:57:19 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02223974 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C4H9N2O7P |
|---|
| Molecular Mass | 228.0147 |
|---|
| SMILES | NC(=O)NC(=O)C(O)COP(=O)(O)O |
|---|
| InChI Key | CIKXJYRAXNFEEI-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic acids and derivatives |
|---|
| Class | organic carbonic acids and derivatives |
|---|
| Subclass | ureas |
|---|
| Direct Parent | n-acyl ureas |
|---|
| Geometric Descriptor | aliphatic acyclic compounds |
|---|
| Alternative Parents | carbonyl compoundscarboxylic acids and derivativesdicarboximideshydrocarbon derivativesmonoalkyl phosphatesmonosaccharidesorganic carbonic acids and derivativesorganic oxidesorganonitrogen compoundsorganopnictogen compoundssecondary alcohols |
|---|
| Substituents | alcoholaliphatic acyclic compoundn-acyl ureacarbonyl groupmonosaccharidecarboxylic acid derivativesaccharideorganic oxideorganic oxygen compoundphosphoric acid estermonoalkyl phosphateorganonitrogen compoundsecondary alcoholorganopnictogen compoundhydrocarbon derivativedicarboximideorganic nitrogen compoundorganic phosphoric acid derivativealkyl phosphateorganooxygen compound |
|---|
