| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 15:09:51 UTC |
|---|
| Update Date | 2025-03-25 00:57:20 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02224133 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C10H15N3O6 |
|---|
| Molecular Mass | 273.0961 |
|---|
| SMILES | O=C(CO)Nc1cnn(C2OC(CO)C(O)C2O)c1 |
|---|
| InChI Key | WQZJHGCOLJIBPH-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | nucleosides, nucleotides, and analogues |
|---|
| Class | pyrazole ribonucleosides and ribonucleotides |
|---|
| Subclass | pyrazole ribonucleosides and ribonucleotides |
|---|
| Direct Parent | pyrazole ribonucleosides and ribonucleotides |
|---|
| Geometric Descriptor | aromatic heteromonocyclic compounds |
|---|
| Alternative Parents | azacyclic compoundscarbonyl compoundscarboxylic acids and derivativesheteroaromatic compoundshydrocarbon derivativesmonosaccharidesn-arylamidesorganic oxidesorganopnictogen compoundsoxacyclic compoundsprimary alcoholspyrazolessecondary alcoholssecondary carboxylic acid amidestetrahydrofurans |
|---|
| Substituents | carbonyl grouparomatic heteromonocyclic compoundmonosacchariden-arylamidecarboxylic acid derivativepyrazole1-ribofuranosylpyrazolesaccharideorganic oxideorganonitrogen compoundorganopnictogen compoundprimary alcoholorganoheterocyclic compoundazolealcoholazacycletetrahydrofuranheteroaromatic compoundcarboxamide groupoxacyclesecondary carboxylic acid amideorganic oxygen compoundsecondary alcoholhydrocarbon derivativeorganic nitrogen compoundorganooxygen compound |
|---|