| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 15:09:51 UTC |
|---|
| Update Date | 2025-03-25 00:57:20 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02224134 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C8H14O11S |
|---|
| Molecular Mass | 318.0257 |
|---|
| SMILES | O=C(CO)OC1C(O)C(O)OC(COS(=O)(=O)O)C1O |
|---|
| InChI Key | KENLIJQTSJLGMQ-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic oxygen compounds |
|---|
| Class | organooxygen compounds |
|---|
| Subclass | carbohydrates and carbohydrate conjugates |
|---|
| Direct Parent | monosaccharides |
|---|
| Geometric Descriptor | aliphatic heteromonocyclic compounds |
|---|
| Alternative Parents | alkyl sulfatescarbonyl compoundscarboxylic acid estershemiacetalshydrocarbon derivativesmonocarboxylic acids and derivativesorganic oxidesoxacyclic compoundsoxanessecondary alcoholssulfuric acid monoesters |
|---|
| Substituents | alcoholsulfuric acid monoestercarbonyl grouporganic sulfuric acid or derivativesmonosaccharidecarboxylic acid derivativeoxacycleorganic oxidemonocarboxylic acid or derivativescarboxylic acid esteralkyl sulfatealiphatic heteromonocyclic compoundsecondary alcoholsulfate-esterhemiacetalhydrocarbon derivativeoxanesulfuric acid esterorganoheterocyclic compound |
|---|
