| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 15:09:53 UTC |
|---|
| Update Date | 2025-03-25 00:57:21 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02224184 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C10H13N5O6S2 |
|---|
| Molecular Mass | 363.0307 |
|---|
| SMILES | Nc1ncnc2c1ncn2C1SC(COS(=O)(=O)O)C(O)C1O |
|---|
| InChI Key | DIBCUHYUBWALNE-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | nucleosides, nucleotides, and analogues |
|---|
| Class | purine nucleosides |
|---|
| Subclass | purine nucleosides |
|---|
| Direct Parent | purine nucleosides |
|---|
| Geometric Descriptor | aromatic heteropolycyclic compounds |
|---|
| Alternative Parents | 1,2-diolsalkyl sulfatesazacyclic compoundsdialkylthioethersheteroaromatic compoundshydrocarbon derivativesimidazolesimidolactamsn-substituted imidazolesorganic oxidesorganopnictogen compoundsprimary aminespurines and purine derivativespyrimidines and pyrimidine derivativessecondary alcoholssulfuric acid monoestersthiolanesthionucleosides |
|---|
| Substituents | thiolanesulfuric acid monoesterimidazopyrimidinepyrimidineorganic oxidearomatic heteropolycyclic compoundimidazolealkyl sulfateorganonitrogen compoundorganopnictogen compoundimidolactampurine thionucleosideorganoheterocyclic compoundazole1,2-dioln-substituted imidazolealcoholorganic sulfuric acid or derivativesazacyclepurine nucleosidedialkylthioetherheteroaromatic compoundorganic oxygen compoundthioethersecondary alcoholsulfate-esterhydrocarbon derivativepurineprimary amineorganic nitrogen compoundsulfuric acid esteramineorganooxygen compound |
|---|
