| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 15:09:54 UTC |
|---|
| Update Date | 2025-03-25 00:57:21 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02224240 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C16H18N2O2S |
|---|
| Molecular Mass | 302.1089 |
|---|
| SMILES | O=C(C=Cc1ccccc1)CCC1SCC2NC(=O)NC21 |
|---|
| InChI Key | TVKWUBYPBMARJF-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | phenylpropanoids and polyketides |
|---|
| Class | cinnamic acids and derivatives |
|---|
| Subclass | cinnamic acids and derivatives |
|---|
| Direct Parent | cinnamic acids and derivatives |
|---|
| Geometric Descriptor | aromatic heteropolycyclic compounds |
|---|
| Alternative Parents | acryloyl compoundsazacyclic compoundsbenzene and substituted derivativesdialkylthioethersenoneshydrocarbon derivativesimidazolidinonesketonesorganic carbonic acids and derivativesorganic oxidesorganonitrogen compoundsorganopnictogen compoundsthienoimidazolidinesthiolanesthiophenes |
|---|
| Substituents | thiolaneimidazolidinemonocyclic benzene moietycarbonyl groupalpha,beta-unsaturated ketonethiopheneketoneimidazolidinonecinnamic acid or derivativesorganic oxidearomatic heteropolycyclic compoundorganonitrogen compoundorganopnictogen compoundorganoheterocyclic compoundenonecarbonic acid derivativeazacycledialkylthioetherthienoimidazolidineorganic oxygen compoundthioetherhydrocarbon derivativebenzenoidacryloyl-grouporganic nitrogen compoundorganooxygen compound |
|---|
