| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 15:09:55 UTC |
|---|
| Update Date | 2025-03-25 00:57:21 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02224261 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C8H9O6P |
|---|
| Molecular Mass | 232.0137 |
|---|
| SMILES | O=C(C(O)c1ccc(O)cc1)P(=O)(O)O |
|---|
| InChI Key | UNSMLIJHFSGFSI-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | benzenoids |
|---|
| Class | phenols |
|---|
| Subclass | 1-hydroxy-2-unsubstituted benzenoids |
|---|
| Direct Parent | 1-hydroxy-2-unsubstituted benzenoids |
|---|
| Geometric Descriptor | aromatic homomonocyclic compounds |
|---|
| Alternative Parents | aromatic alcoholsbenzene and substituted derivativeshydrocarbon derivativesorganic oxidesorganic phosphonic acids and derivativesorganophosphorus compoundsorganopnictogen compoundssecondary alcohols |
|---|
| Substituents | aromatic alcoholalcoholmonocyclic benzene moiety1-hydroxy-2-unsubstituted benzenoidaromatic homomonocyclic compoundorganic oxideorganic oxygen compoundsecondary alcoholorganopnictogen compoundorganophosphorus compoundhydrocarbon derivativeorganophosphonic acid derivativeorganooxygen compound |
|---|
