| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 15:09:55 UTC |
|---|
| Update Date | 2025-03-25 00:57:22 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02224269 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C15H19ClN2O2 |
|---|
| Molecular Mass | 294.1135 |
|---|
| SMILES | O=C(C1CCCN1)N1CCC(Oc2ccc(Cl)cc2)C1 |
|---|
| InChI Key | JSNNYWHKRPTDAI-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic acids and derivatives |
|---|
| Class | carboxylic acids and derivatives |
|---|
| Subclass | amino acids, peptides, and analogues |
|---|
| Direct Parent | alpha amino acid amides |
|---|
| Geometric Descriptor | aromatic heteromonocyclic compounds |
|---|
| Alternative Parents | alkyl aryl ethersalpha amino acidsaryl chloridesazacyclic compoundscarbonyl compoundscarboxylic acids and derivativeschlorobenzenesdialkylamineshydrocarbon derivativesn-acylpyrrolidinesorganic oxidesorganochloridesorganopnictogen compoundsphenol ethersphenoxy compoundspyrrolidinecarboxamidestertiary carboxylic acid amides |
|---|
| Substituents | phenol ethermonocyclic benzene moietycarbonyl groupetheraromatic heteromonocyclic compoundorganochloriden-acylpyrrolidinealkyl aryl etherorganohalogen compoundorganic oxidetertiary carboxylic acid amideorganonitrogen compoundalpha-amino acidorganopnictogen compoundpyrrolidineorganoheterocyclic compoundaryl chloridechlorobenzenesecondary aliphatic aminealpha-amino acid amideazacyclesecondary aminecarboxamide grouparyl halidepyrrolidine carboxylic acid or derivativesorganic oxygen compoundhydrocarbon derivativebenzenoidorganic nitrogen compoundhalobenzenepyrrolidine-2-carboxamidephenoxy compoundorganooxygen compoundamine |
|---|