| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 15:09:57 UTC |
|---|
| Update Date | 2025-03-25 00:57:22 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02224367 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C6H11O9P |
|---|
| Molecular Mass | 258.0141 |
|---|
| SMILES | O=C(O)C1(O)CC(O)(COP(=O)(O)O)CO1 |
|---|
| InChI Key | PZOGQWKJKXTAMW-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | lipids and lipid-like molecules |
|---|
| Class | glycerophospholipids |
|---|
| Subclass | glycerophospholipids |
|---|
| Direct Parent | glycerophospholipids |
|---|
| Geometric Descriptor | aliphatic heteromonocyclic compounds |
|---|
| Alternative Parents | alpha hydroxy acids and derivativescarbonyl compoundscarboxylic acidshemiacetalshydrocarbon derivativesmonoalkyl phosphatesmonocarboxylic acids and derivativesorganic oxidesoxacyclic compoundstertiary alcoholstetrahydrofurans |
|---|
| Substituents | alcoholcarbonyl groupcarboxylic acidtetrahydrofuranalpha-hydroxy acidhydroxy acidcarboxylic acid derivativeoxacycletertiary alcoholorganic oxidemonocarboxylic acid or derivativesorganic oxygen compoundphosphoric acid estermonoalkyl phosphatealiphatic heteromonocyclic compoundhemiacetalglycerophospholipidhydrocarbon derivativeorganic phosphoric acid derivativealkyl phosphateorganoheterocyclic compoundorganooxygen compound |
|---|
