| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 15:10:01 UTC |
|---|
| Update Date | 2025-03-25 00:57:24 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02224496 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C20H24N2O10P+ |
|---|
| Molecular Mass | 483.1163 |
|---|
| SMILES | O=C(NC(Cc1ccccc1)C(=O)O)c1ccc[n+](C2OC(COP(=O)(O)O)C(O)C2O)c1 |
|---|
| InChI Key | DWKVQIWLROAIAC-UHFFFAOYSA-O |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | nucleosides, nucleotides, and analogues |
|---|
| Class | pyridine nucleotides |
|---|
| Subclass | pyridine nucleotides |
|---|
| Direct Parent | pyridine nucleotides |
|---|
| Geometric Descriptor | aromatic heteromonocyclic compounds |
|---|
| Alternative Parents | 1,2-diolsalpha amino acidsamphetamines and derivativesazacyclic compoundsbenzene and substituted derivativescarbonyl compoundscarboxylic acidsheteroaromatic compoundshydrocarbon derivativeshydroxypyridinesmonoalkyl phosphatesmonocarboxylic acids and derivativesmonosaccharidesn-acyl-alpha amino acidsnicotinamidesorganic cationsorganic oxidesorganonitrogen compoundsorganopnictogen compoundsoxacyclic compoundspentose phosphatesphenylalanine and derivativesphenylpropanoic acidspyridinecarboxylic acids and derivativessecondary alcoholssecondary carboxylic acid amidestetrahydrofuransvinylogous amides |
|---|
| Substituents | pyridine carboxylic acid or derivativesmonocyclic benzene moietycarbonyl groupcarboxylic acidaromatic heteromonocyclic compound3-phenylpropanoic-acidpentose phosphatenicotinamidemonosaccharidepentose-5-phosphatealpha-amino acid or derivativescarboxylic acid derivativesaccharideorganic oxideorganonitrogen compoundalpha-amino acidorganopnictogen compoundorganic cationorganoheterocyclic compoundamphetamine or derivatives1,2-dioln-acyl-alpha amino acid or derivativespyridine nucleotidealcoholvinylogous amideazacyclen-acyl-alpha-amino acidtetrahydrofuranheteroaromatic compoundhydroxypyridinecarboxamide groupoxacyclesecondary carboxylic acid amidemonocarboxylic acid or derivativespyridinephenylalanine or derivativesorganic oxygen compoundphosphoric acid estermonoalkyl phosphatesecondary alcoholhydrocarbon derivativebenzenoidorganic nitrogen compoundorganic phosphoric acid derivativealkyl phosphateorganooxygen compound |
|---|