| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 15:10:01 UTC |
|---|
| Update Date | 2025-03-25 00:57:24 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02224502 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C21H15FN2O2 |
|---|
| Molecular Mass | 346.1118 |
|---|
| SMILES | O=C(Nc1ccc(O)cc1)c1c(-c2ccc(F)cc2)[nH]c2ccccc12 |
|---|
| InChI Key | BLXJJKMJIPZCEP-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | benzenoids |
|---|
| Class | benzene and substituted derivatives |
|---|
| Subclass | anilides |
|---|
| Direct Parent | aromatic anilides |
|---|
| Geometric Descriptor | aromatic heteropolycyclic compounds |
|---|
| Alternative Parents | 1-hydroxy-2-unsubstituted benzenoidsaryl fluoridesazacyclic compoundscarboxylic acids and derivativesfluorobenzenesheteroaromatic compoundshydrocarbon derivativesindolecarboxamides and derivativesindolesorganic oxidesorganofluoridesorganonitrogen compoundsorganooxygen compoundsorganopnictogen compoundspyrrole carboxamidessecondary carboxylic acid amidesvinylogous amides |
|---|
| Substituents | aryl fluorideindolecarboxamide derivativepyrrole-3-carboxylic acid or derivativesindole1-hydroxy-2-unsubstituted benzenoidcarboxylic acid derivativeorganohalogen compoundaromatic anilidefluorobenzeneorganic oxidearomatic heteropolycyclic compoundorganonitrogen compoundpyrrole-3-carboxamideorganopnictogen compoundorganoheterocyclic compoundindolecarboxylic acid derivativevinylogous amideazacycleorganofluorideheteroaromatic compoundindole or derivativescarboxamide grouparyl halidesecondary carboxylic acid amideorganic oxygen compoundpyrrolephenolhydrocarbon derivativeorganic nitrogen compoundhalobenzeneorganooxygen compound |
|---|
