| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 15:10:01 UTC |
|---|
| Update Date | 2025-03-25 00:57:24 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02224507 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C13H17NO7 |
|---|
| Molecular Mass | 299.1005 |
|---|
| SMILES | O=C(Nc1ccccc1)OC1C(O)OC(CO)C(O)C1O |
|---|
| InChI Key | HLIFBOSTKQJJBP-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | benzenoids |
|---|
| Class | benzene and substituted derivatives |
|---|
| Subclass | phenylcarbamic acid esters |
|---|
| Direct Parent | phenylcarbamic acid esters |
|---|
| Geometric Descriptor | aromatic heteromonocyclic compounds |
|---|
| Alternative Parents | carbamate esterscarbonyl compoundshemiacetalshydrocarbon derivativesmonosaccharidesorganic carbonic acids and derivativesorganic oxidesorganonitrogen compoundsorganopnictogen compoundsoxacyclic compoundsoxanesprimary alcoholssecondary alcohols |
|---|
| Substituents | alcoholcarbonyl groupcarbonic acid derivativearomatic heteromonocyclic compoundmonosaccharidecarbamic acid esteroxacyclesaccharideorganic oxideorganic oxygen compoundorganonitrogen compoundsecondary alcoholorganopnictogen compoundhemiacetalhydrocarbon derivativephenylcarbamic acid esterorganic nitrogen compoundoxaneprimary alcoholorganoheterocyclic compoundorganooxygen compound |
|---|
