| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 15:10:02 UTC |
|---|
| Update Date | 2025-03-25 00:57:24 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02224520 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C13H17ClN2O2 |
|---|
| Molecular Mass | 268.0979 |
|---|
| SMILES | O=C(Nc1ccc(Cl)cc1)NC1CCC(O)CC1 |
|---|
| InChI Key | YNCFFKZYHRIFSY-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | benzenoids |
|---|
| Class | benzene and substituted derivatives |
|---|
| Subclass | n-phenylureas |
|---|
| Direct Parent | n-phenylureas |
|---|
| Geometric Descriptor | aromatic homomonocyclic compounds |
|---|
| Alternative Parents | aryl chloridescarbonyl compoundschlorobenzenescyclic alcohols and derivativescyclohexanolshydrocarbon derivativesorganic carbonic acids and derivativesorganic oxidesorganochloridesorganonitrogen compoundsorganopnictogen compounds |
|---|
| Substituents | aryl chloridechlorobenzenealcoholcarbonyl groupcarbonic acid derivativeorganochloridecyclohexanolcyclic alcoholorganohalogen compoundaryl halidearomatic homomonocyclic compoundn-phenylureaorganic oxideorganic oxygen compoundorganonitrogen compoundsecondary alcoholorganopnictogen compoundhydrocarbon derivativeorganic nitrogen compoundhalobenzeneorganooxygen compound |
|---|