| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 15:10:03 UTC |
|---|
| Update Date | 2025-03-25 00:57:24 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02224574 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C3H7O8PS |
|---|
| Molecular Mass | 233.9599 |
|---|
| SMILES | O=C(O)C(COP(=O)(O)O)S(=O)O |
|---|
| InChI Key | VNBNWFVPSBZCER-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic acids and derivatives |
|---|
| Class | organic phosphoric acids and derivatives |
|---|
| Subclass | phosphate esters |
|---|
| Direct Parent | monoalkyl phosphates |
|---|
| Geometric Descriptor | aliphatic acyclic compounds |
|---|
| Alternative Parents | alkanesulfinic acids and derivativescarbonyl compoundscarboxylic acidshydrocarbon derivativesmonocarboxylic acids and derivativesorganic oxidesorganosulfur compoundssulfinic acids |
|---|
| Substituents | aliphatic acyclic compoundcarbonyl groupcarboxylic acidsulfinic acid derivativeorganosulfur compoundcarboxylic acid derivativesulfinic acidalkanesulfinic acid or derivativesorganic oxidemonocarboxylic acid or derivativesorganic oxygen compoundmonoalkyl phosphatehydrocarbon derivativeorganooxygen compound |
|---|
