| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 15:10:03 UTC |
|---|
| Update Date | 2025-03-25 00:57:24 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02224576 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C6H13O9P |
|---|
| Molecular Mass | 260.0297 |
|---|
| SMILES | O=C(O)C(CO)OCC(O)COP(=O)(O)O |
|---|
| InChI Key | CCAUHUGBLORUCF-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | lipids and lipid-like molecules |
|---|
| Class | glycerophospholipids |
|---|
| Subclass | glycerophosphates |
|---|
| Direct Parent | glycerophosphates |
|---|
| Geometric Descriptor | aliphatic acyclic compounds |
|---|
| Alternative Parents | beta hydroxy acids and derivativescarbonyl compoundscarboxylic acidsdialkyl ethersglycerol ethershydrocarbon derivativesmonoalkyl phosphatesmonocarboxylic acids and derivativesorganic oxidesprimary alcoholssecondary alcoholssugar acids and derivatives |
|---|
| Substituents | aliphatic acyclic compoundsn-glycerol-3-phosphatecarbonyl groupethercarboxylic acidcarboxylic acid derivativedialkyl etherbeta-hydroxy acidorganic oxideglyceric_acidprimary alcoholglycerol etheralcoholhydroxy acidmonocarboxylic acid or derivativesorganic oxygen compoundphosphoric acid estermonoalkyl phosphatesecondary alcoholhydrocarbon derivativeorganic phosphoric acid derivativealkyl phosphateorganooxygen compound |
|---|
