| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 15:10:05 UTC |
|---|
| Update Date | 2025-03-25 00:57:24 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02224623 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C3H3F8NO3S2 |
|---|
| Molecular Mass | 316.9427 |
|---|
| SMILES | NS(=O)(=O)C(F)(F)C(F)(F)C(F)(F)[SH](=O)(F)F |
|---|
| InChI Key | GAJQSVYREDIEFM-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic acids and derivatives |
|---|
| Class | organic sulfonic acids and derivatives |
|---|
| Subclass | organic sulfonamides |
|---|
| Direct Parent | organic sulfonamides |
|---|
| Geometric Descriptor | aliphatic acyclic compounds |
|---|
| Alternative Parents | alkyl fluoridesalkylthiolsaminosulfonyl compoundshydrocarbon derivativesorganic nitrogen compoundsorganic oxidesorganofluoridesorganosulfonamides |
|---|
| Substituents | aliphatic acyclic compoundorganosulfonic acid or derivativesaminosulfonyl compoundalkyl fluorideorganofluorideorganosulfur compoundorganohalogen compoundorganosulfonic acid amideorganic oxidesulfonylorganic oxygen compoundalkyl halidehydrocarbon derivativeorganic nitrogen compoundorganic sulfonic acid amidealkylthiol |
|---|