| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 15:10:05 UTC |
|---|
| Update Date | 2025-03-25 00:57:25 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02224639 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C8H14N3O9PS |
|---|
| Molecular Mass | 359.0188 |
|---|
| SMILES | NS(=O)(=O)c1ccn(C2OC(COP(=O)(O)O)C(O)C2O)n1 |
|---|
| InChI Key | PMQITWXWAIVSIX-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic oxygen compounds |
|---|
| Class | organooxygen compounds |
|---|
| Subclass | carbohydrates and carbohydrate conjugates |
|---|
| Direct Parent | pentose phosphates |
|---|
| Geometric Descriptor | aromatic heteromonocyclic compounds |
|---|
| Alternative Parents | 1,2-diolsaminosulfonyl compoundsazacyclic compoundsheteroaromatic compoundshydrocarbon derivativesmonoalkyl phosphatesmonosaccharidesorganic oxidesorganonitrogen compoundsorganopnictogen compoundsorganosulfonamidesoxacyclic compoundspyrazole ribonucleosides and ribonucleotidespyrazolessecondary alcoholstetrahydrofurans |
|---|
| Substituents | organosulfonic acid or derivativesaromatic heteromonocyclic compoundpentose phosphatepentose-5-phosphateorganosulfur compoundpyrazole1-ribofuranosylpyrazoleorganosulfonic acid amideorganic oxideorganonitrogen compoundorganopnictogen compoundorganoheterocyclic compoundazole1,2-diolalcoholazacycleaminosulfonyl compoundtetrahydrofuranheteroaromatic compoundoxacyclesulfonylphosphoric acid esterorganic sulfonic acid or derivativesmonoalkyl phosphatesecondary alcoholhydrocarbon derivativeorganic nitrogen compoundorganic phosphoric acid derivativealkyl phosphate |
|---|
