| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 15:10:07 UTC |
|---|
| Update Date | 2025-03-25 00:57:26 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02224708 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C15H12NO3+ |
|---|
| Molecular Mass | 254.0812 |
|---|
| SMILES | Nc1cc2ccc(O)cc2[o+]c1-c1ccc(O)cc1 |
|---|
| InChI Key | WLZFEFQICCGTIL-UHFFFAOYSA-O |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | phenylpropanoids and polyketides |
|---|
| Class | flavonoids |
|---|
| Subclass | hydroxyflavonoids |
|---|
| Direct Parent | 7-hydroxyflavonoids |
|---|
| Geometric Descriptor | aromatic heteropolycyclic compounds |
|---|
| Alternative Parents | 1-benzopyrans1-hydroxy-2-unsubstituted benzenoids4'-hydroxyflavonoidsanthocyanidinsbenzene and substituted derivativesheteroaromatic compoundshydrocarbon derivativesorganic cationsorganooxygen compoundsorganopnictogen compoundsoxacyclic compoundsprimary amines |
|---|
| Substituents | monocyclic benzene moietybenzopyran1-benzopyranheteroaromatic compound1-hydroxy-2-unsubstituted benzenoidoxacycleorganic oxygen compoundaromatic heteropolycyclic compound7-hydroxyflavonoidorganonitrogen compoundorganopnictogen compound4'-hydroxyflavonoidanthocyanidinphenolhydrocarbon derivativebenzenoidprimary amineorganic nitrogen compoundorganic cationamineorganoheterocyclic compoundorganooxygen compound |
|---|