| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 15:10:08 UTC |
|---|
| Update Date | 2025-03-25 00:57:26 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02224745 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C18H23N4O11P |
|---|
| Molecular Mass | 502.1101 |
|---|
| SMILES | Nc1c(C(=O)NC(Cc2ccc(O)cc2)C(=O)O)ncn1C1OC(CO)C(OP(=O)(O)O)C1O |
|---|
| InChI Key | QWUWSTCWYIMKFS-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic acids and derivatives |
|---|
| Class | carboxylic acids and derivatives |
|---|
| Subclass | amino acids, peptides, and analogues |
|---|
| Direct Parent | tyrosine and derivatives |
|---|
| Geometric Descriptor | aromatic heteromonocyclic compounds |
|---|
| Alternative Parents | 1-hydroxy-2-unsubstituted benzenoids1-ribosyl-imidazolecarboxamides2-heteroaryl carboxamidesalpha amino acidsamino acidsamphetamines and derivativesazacyclic compoundsbenzene and substituted derivativescarbonyl compoundscarbonylimidazolescarboxylic acidsheteroaromatic compoundshydrocarbon derivativesimidazolesmonoalkyl phosphatesmonocarboxylic acids and derivativesmonosaccharidesn-acyl-alpha amino acidsn-substituted imidazolesorganic oxidesorganopnictogen compoundsoxacyclic compoundspentose phosphatesphenylalanine and derivativesphenylpropanoic acidsprimary alcoholsprimary aminessecondary alcoholssecondary carboxylic acid amidestetrahydrofuransvinylogous amides |
|---|
| Substituents | monocyclic benzene moietycarboxylic acidmonosaccharide2-heteroaryl carboxamidesaccharideorganonitrogen compoundalpha-amino acidorganoheterocyclic compoundn-acyl-alpha amino acid or derivativesalcoholvinylogous amidetyrosine or derivativesazacyclen-acyl-alpha-amino acidheteroaromatic compoundsecondary carboxylic acid amidemonoalkyl phosphatephenolhydrocarbon derivativeprimary amineaminecarbonyl groupimidazole ribonucleosidearomatic heteromonocyclic compound3-phenylpropanoic-acidpentose phosphateamino acid1-hydroxy-2-unsubstituted benzenoidorganic oxideimidazoleorganopnictogen compoundimidazole-4-carbonyl groupprimary alcoholamphetamine or derivativesazolen-substituted imidazoletetrahydrofurancarboxamide group1-ribosyl-imidazolecarboxamideoxacyclemonocarboxylic acid or derivativesphenylalanine or derivativesorganic oxygen compoundphosphoric acid estersecondary alcoholbenzenoidorganic nitrogen compoundorganic phosphoric acid derivativealkyl phosphateorganooxygen compound |
|---|