| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 15:10:13 UTC |
|---|
| Update Date | 2025-03-25 00:57:28 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02224938 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C10H14N6O2 |
|---|
| Molecular Mass | 250.1178 |
|---|
| SMILES | Nc1nc2c(ncn2C2CC(N)C(O)C2)c(=O)[nH]1 |
|---|
| InChI Key | ZOTBKAUBKICCRO-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organoheterocyclic compounds |
|---|
| Class | imidazopyrimidines |
|---|
| Subclass | purines and purine derivatives |
|---|
| Direct Parent | hypoxanthines |
|---|
| Geometric Descriptor | aromatic heteropolycyclic compounds |
|---|
| Alternative Parents | azacyclic compoundscyclic alcohols and derivativescyclopentanolsheteroaromatic compoundshydrocarbon derivativesimidazoleslactamsmonoalkylaminesn-substituted imidazolesorganic oxidesorganopnictogen compoundspurines and purine derivativespyrimidonesvinylogous amides |
|---|
| Substituents | lactampyrimidonepyrimidineorganic oxidearomatic heteropolycyclic compoundimidazoleorganonitrogen compoundorganopnictogen compoundazolen-substituted imidazolealcoholvinylogous amideazacycleheteroaromatic compoundcyclic alcoholcyclopentanolorganic oxygen compoundsecondary alcoholhypoxanthinehydrocarbon derivativeprimary aliphatic amineprimary amineorganic nitrogen compoundamineorganooxygen compound |
|---|
