| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 15:10:15 UTC |
|---|
| Update Date | 2025-03-25 00:57:28 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02224994 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C10H14N5O6P |
|---|
| Molecular Mass | 331.0682 |
|---|
| SMILES | Nc1ncnc2c1ncn2C1CC(O)(P(=O)(O)O)C(CO)O1 |
|---|
| InChI Key | UINQAEZFPBOESK-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organoheterocyclic compounds |
|---|
| Class | imidazopyrimidines |
|---|
| Subclass | purines and purine derivatives |
|---|
| Direct Parent | purines and purine derivatives |
|---|
| Geometric Descriptor | aromatic heteropolycyclic compounds |
|---|
| Alternative Parents | azacyclic compoundsheteroaromatic compoundshydrocarbon derivativesimidazolesimidolactamsmonosaccharidesn-substituted imidazolesorganic oxidesorganic phosphonic acids and derivativesorganophosphorus compoundsorganopnictogen compoundsoxacyclic compoundsprimary alcoholsprimary aminespyrimidines and pyrimidine derivativestetrahydrofurans |
|---|
| Substituents | monosaccharidepyrimidinesaccharideorganic oxidearomatic heteropolycyclic compoundimidazoleorganonitrogen compoundorganopnictogen compoundorganophosphorus compoundprimary alcoholimidolactamorganophosphonic acid derivativeazolen-substituted imidazolealcoholazacycletetrahydrofuranheteroaromatic compoundoxacycleorganic oxygen compoundhydrocarbon derivativeprimary aminepurineorganic nitrogen compoundamineorganooxygen compound |
|---|
