| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 15:10:15 UTC |
|---|
| Update Date | 2025-03-25 00:57:28 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02224995 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C11H15N4O6P |
|---|
| Molecular Mass | 330.0729 |
|---|
| SMILES | Nc1ncnc2c1ccn2C1CC(O)C(OP(=O)(O)O)C1O |
|---|
| InChI Key | ATMFFNFXCMCAJL-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organoheterocyclic compounds |
|---|
| Class | pyrrolopyrimidines |
|---|
| Subclass | pyrrolo[2,3-d]pyrimidines |
|---|
| Direct Parent | pyrrolo[2,3-d]pyrimidines |
|---|
| Geometric Descriptor | aromatic heteropolycyclic compounds |
|---|
| Alternative Parents | azacyclic compoundscyclitols and derivativescyclopentanolsheteroaromatic compoundshydrocarbon derivativesimidolactamsmonoalkyl phosphatesorganic oxidesorganopnictogen compoundsprimary aminespyrimidines and pyrimidine derivativessubstituted pyrroles |
|---|
| Substituents | substituted pyrrolepyrimidineorganic oxidepyrrolo[2,3-d]pyrimidinearomatic heteropolycyclic compoundorganonitrogen compoundorganopnictogen compoundimidolactamalcoholazacycleheteroaromatic compoundcyclitol or derivativescyclic alcoholcyclopentanolorganic oxygen compoundphosphoric acid estermonoalkyl phosphatepyrrolesecondary alcoholhydrocarbon derivativeprimary amineorganic nitrogen compoundorganic phosphoric acid derivativeaminealkyl phosphateorganooxygen compound |
|---|
