| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 15:10:15 UTC |
|---|
| Update Date | 2025-03-25 00:57:28 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02224998 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C13H10N8 |
|---|
| Molecular Mass | 278.1028 |
|---|
| SMILES | Nc1ncnc2c1c(N)nc1nc(-c3ccccc3)nn12 |
|---|
| InChI Key | JRDAMGSDDMZVJJ-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organoheterocyclic compounds |
|---|
| Class | azoles |
|---|
| Subclass | triazoles |
|---|
| Direct Parent | phenyl-1,2,4-triazoles |
|---|
| Geometric Descriptor | aromatic heteropolycyclic compounds |
|---|
| Alternative Parents | azacyclic compoundsbenzene and substituted derivativesheteroaromatic compoundshydrocarbon derivativesimidolactamsorganopnictogen compoundsprimary aminespyrimidines and pyrimidine derivativestriazolopyrimidines |
|---|
| Substituents | monocyclic benzene moietyphenyl-1,2,4-triazoleazacycleheteroaromatic compoundpyrimidinearomatic heteropolycyclic compoundorganonitrogen compoundorganopnictogen compoundhydrocarbon derivativebenzenoidprimary amineorganic nitrogen compoundimidolactamtriazolopyrimidineamine |
|---|
