| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 15:10:15 UTC |
|---|
| Update Date | 2025-03-25 00:57:28 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02225006 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C17H20N6O4 |
|---|
| Molecular Mass | 372.1546 |
|---|
| SMILES | Nc1ncnc2c1ncn2C1OC(CNCc2ccccc2O)C(O)C1O |
|---|
| InChI Key | NNMCIXYELLJUCD-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | nucleosides, nucleotides, and analogues |
|---|
| Class | 5'-deoxyribonucleosides |
|---|
| Subclass | 5'-deoxyribonucleosides |
|---|
| Direct Parent | 5'-deoxyribonucleosides |
|---|
| Geometric Descriptor | aromatic heteropolycyclic compounds |
|---|
| Alternative Parents | 1,2-diols1-hydroxy-2-unsubstituted benzenoids1-hydroxy-4-unsubstituted benzenoidsazacyclic compoundsbenzene and substituted derivativesdialkylaminesheteroaromatic compoundshydrocarbon derivativesimidazolesimidolactamsmonosaccharidesn-substituted imidazolesorganopnictogen compoundsoxacyclic compoundsprimary aminespurines and purine derivativespyrimidines and pyrimidine derivativessecondary alcoholstetrahydrofurans |
|---|
| Substituents | monocyclic benzene moiety1-hydroxy-2-unsubstituted benzenoidmonosaccharideimidazopyrimidinepyrimidinesaccharidearomatic heteropolycyclic compoundimidazoleorganonitrogen compoundorganopnictogen compoundimidolactamorganoheterocyclic compoundazole1,2-dioln-substituted imidazolealcoholsecondary aliphatic amine5'-deoxyribonucleosideazacycletetrahydrofuranheteroaromatic compound1-hydroxy-4-unsubstituted benzenoidsecondary amineoxacycleorganic oxygen compoundsecondary alcoholphenolhydrocarbon derivativebenzenoidprimary aminepurineorganic nitrogen compoundamineorganooxygen compound |
|---|