| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 15:10:16 UTC |
|---|
| Update Date | 2025-03-25 00:57:28 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02225035 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C8H10N6O3 |
|---|
| Molecular Mass | 238.0814 |
|---|
| SMILES | Nc1nc2ncc(C(O)C(N)O)nc2c(=O)[nH]1 |
|---|
| InChI Key | UGVONKUUXQIQTN-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organoheterocyclic compounds |
|---|
| Class | pteridines and derivatives |
|---|
| Subclass | pterins and derivatives |
|---|
| Direct Parent | pterins and derivatives |
|---|
| Geometric Descriptor | aromatic heteropolycyclic compounds |
|---|
| Alternative Parents | aromatic alcoholsazacyclic compoundshemiaminalsheteroaromatic compoundshydrocarbon derivativeslactamsmonoalkylaminesorganic oxidesorganopnictogen compoundspyrazinespyrimidonessecondary alcohols |
|---|
| Substituents | aromatic alcohollactampyrimidonehemiaminalpyrimidineorganic oxidearomatic heteropolycyclic compoundorganonitrogen compoundorganopnictogen compoundalkanolaminealcoholpterinazacycleheteroaromatic compoundorganic oxygen compoundpyrazinesecondary alcoholhydrocarbon derivativeprimary aliphatic amineprimary amineorganic nitrogen compoundamineorganooxygen compound |
|---|
