| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 15:10:19 UTC |
|---|
| Update Date | 2025-03-25 00:57:30 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02225129 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C13H12N6O2 |
|---|
| Molecular Mass | 284.1022 |
|---|
| SMILES | Nc1nc(N)c2cc(-c3ccc(O)c(O)c3)c(N)nc2n1 |
|---|
| InChI Key | ARDTZBIRNZHIGV-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organoheterocyclic compounds |
|---|
| Class | pyridopyrimidines |
|---|
| Subclass | pyrido[2,3-d]pyrimidines |
|---|
| Direct Parent | pyrido[2,3-d]pyrimidines |
|---|
| Geometric Descriptor | aromatic heteropolycyclic compounds |
|---|
| Alternative Parents | 1-hydroxy-2-unsubstituted benzenoids1-hydroxy-4-unsubstituted benzenoids2-halopyridinesazacyclic compoundsbenzene and substituted derivativesheteroaromatic compoundshydrocarbon derivativeshydroxypyridinesimidolactamsorganooxygen compoundsorganopnictogen compoundspolyhalopyridinesprimary aminespyrimidines and pyrimidine derivatives |
|---|
| Substituents | monocyclic benzene moietypolyhalopyridine1-hydroxy-2-unsubstituted benzenoidpyrimidinearomatic heteropolycyclic compoundorganonitrogen compoundorganopnictogen compound2-halopyridineimidolactamazacycleheteroaromatic compoundhydroxypyridine1-hydroxy-4-unsubstituted benzenoidpyridinepyrido[2,3-d]pyrimidineorganic oxygen compoundphenolhydrocarbon derivativebenzenoidprimary amineorganic nitrogen compoundamineorganooxygen compound |
|---|
