| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 15:10:19 UTC |
|---|
| Update Date | 2025-03-25 00:57:30 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02225132 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C8H10N3O6P |
|---|
| Molecular Mass | 275.0307 |
|---|
| SMILES | Nc1nc(=O)ccn1C1OC2COP(=O)(O)OC21 |
|---|
| InChI Key | SRKZLOKJVCUMMS-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organoheterocyclic compounds |
|---|
| Class | diazines |
|---|
| Subclass | pyrimidines and pyrimidine derivatives |
|---|
| Direct Parent | pyrimidones |
|---|
| Geometric Descriptor | aromatic heteropolycyclic compounds |
|---|
| Alternative Parents | azacyclic compoundsheteroaromatic compoundshydrocarbon derivativesorganic oxidesorganic phosphoric acids and derivativesorganooxygen compoundsorganopnictogen compoundsoxacyclic compoundsoxetanesprimary aminesvinylogous amides |
|---|
| Substituents | vinylogous amideazacycleheteroaromatic compoundpyrimidoneoxacycleorganic oxideorganic oxygen compoundaromatic heteropolycyclic compoundoxetaneorganonitrogen compoundorganopnictogen compoundhydrocarbon derivativeprimary amineorganic nitrogen compoundorganic phosphoric acid derivativeamineorganooxygen compound |
|---|