| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 15:10:20 UTC |
|---|
| Update Date | 2025-03-25 00:57:30 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02225167 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C5H6N6O2 |
|---|
| Molecular Mass | 182.0552 |
|---|
| SMILES | Nc1nc(=O)c2[nH]c(NO)nc2[nH]1 |
|---|
| InChI Key | CUZLQCLEQWYRIX-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organoheterocyclic compounds |
|---|
| Class | imidazopyrimidines |
|---|
| Subclass | purines and purine derivatives |
|---|
| Direct Parent | hypoxanthines |
|---|
| Geometric Descriptor | aromatic heteropolycyclic compounds |
|---|
| Alternative Parents | azacyclic compoundsheteroaromatic compoundshydrocarbon derivativesimidazolesn-organohydroxylaminesorganic oxidesorganooxygen compoundsorganopnictogen compoundsprimary aminespurines and purine derivativespyrimidonesvinylogous amides |
|---|
| Substituents | vinylogous amideazacycleheteroaromatic compoundpyrimidonen-organohydroxylaminepyrimidineorganic oxideorganic oxygen compoundaromatic heteropolycyclic compoundimidazoleorganonitrogen compoundorganopnictogen compoundhypoxanthinehydrocarbon derivativeprimary amineorganic nitrogen compoundamineorganooxygen compoundazole |
|---|
