| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 15:10:21 UTC |
|---|
| Update Date | 2025-03-25 00:57:30 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02225198 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C18H19NO3 |
|---|
| Molecular Mass | 297.1365 |
|---|
| SMILES | CC(C(=O)O)c1ccc(C(C)C(=O)c2ccc(N)cc2)cc1 |
|---|
| InChI Key | OAMWGPFIQOXYSK-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | phenylpropanoids and polyketides |
|---|
| Class | stilbenes |
|---|
| Subclass | stilbenes |
|---|
| Direct Parent | stilbenes |
|---|
| Geometric Descriptor | aromatic homomonocyclic compounds |
|---|
| Alternative Parents | alkyl-phenylketonesamino acidsaromatic monoterpenoidsaryl alkyl ketonesbenzoyl derivativescarboxylic acidshydrocarbon derivativesmonocarboxylic acids and derivativesmonocyclic monoterpenoidsorganic oxidesorganopnictogen compoundsphenylpropanesphenylpropanoic acidsprimary amines |
|---|
| Substituents | monoterpenoidmonocyclic benzene moietycarbonyl groupmonocyclic monoterpenoidcarboxylic acidaryl alkyl ketoneamino acid or derivativesamino acidbenzoylp-cymenecarboxylic acid derivativeketonephenylpropaneorganic oxide2-phenylpropanoic-acidorganonitrogen compoundorganopnictogen compoundphenylketonearomatic homomonocyclic compoundmonocarboxylic acid or derivativesorganic oxygen compoundhydrocarbon derivativebenzenoidprimary amineorganic nitrogen compoundaminealkyl-phenylketoneorganooxygen compoundaromatic monoterpenoidaryl ketonestilbene |
|---|
