| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 15:10:26 UTC |
|---|
| Update Date | 2025-03-25 00:57:32 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02225383 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C14H21N2O8P |
|---|
| Molecular Mass | 376.1036 |
|---|
| SMILES | CC(=O)Nc1ccccc1NCC1OC(COP(=O)(O)O)C(O)C1O |
|---|
| InChI Key | XBGXESZNJMQGOJ-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic oxygen compounds |
|---|
| Class | organooxygen compounds |
|---|
| Subclass | carbohydrates and carbohydrate conjugates |
|---|
| Direct Parent | pentose phosphates |
|---|
| Geometric Descriptor | aromatic heteromonocyclic compounds |
|---|
| Alternative Parents | 1,2-diolsacetamidesacetanilidesamino acids and derivativescarbonyl compoundscarboxylic acids and derivativesdialkyl ethershydrocarbon derivativesmonoalkyl phosphatesmonosaccharidesn-acetylarylaminesorganic oxidesorganopnictogen compoundsoxacyclic compoundsphenylalkylaminessecondary alcoholssecondary alkylarylaminessecondary carboxylic acid amidestetrahydrofurans |
|---|
| Substituents | monocyclic benzene moietycarbonyl groupethern-acetylarylaminearomatic heteromonocyclic compoundpentose phosphateamino acid or derivativespentose-5-phosphaten-arylamidecarboxylic acid derivativedialkyl etherorganic oxideorganonitrogen compoundorganopnictogen compoundorganoheterocyclic compoundacetamide1,2-diolalcoholacetanilidetetrahydrofuransecondary aminecarboxamide groupsecondary aliphatic/aromatic amineanilideoxacyclesecondary carboxylic acid amidephosphoric acid estermonoalkyl phosphatesecondary alcoholphenylalkylaminehydrocarbon derivativebenzenoidorganic nitrogen compoundorganic phosphoric acid derivativeaminealkyl phosphate |
|---|