| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 15:10:27 UTC |
|---|
| Update Date | 2025-03-25 00:57:32 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02225406 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C8H9IN2O4S |
|---|
| Molecular Mass | 355.9328 |
|---|
| SMILES | CC(=O)Nc1ccc(OS(N)(=O)=O)c(I)c1 |
|---|
| InChI Key | BXZWKRYVHVFOTB-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | benzenoids |
|---|
| Class | benzene and substituted derivatives |
|---|
| Subclass | anilides |
|---|
| Direct Parent | m-haloacetanilides |
|---|
| Geometric Descriptor | aromatic homomonocyclic compounds |
|---|
| Alternative Parents | acetamidesaryl iodidescarbonyl compoundscarboxylic acids and derivativeshydrocarbon derivativesiodobenzenesn-acetylarylaminesorganic oxidesorganic sulfuric acids and derivativesorganoiodidesorganopnictogen compoundsphenoxy compoundssecondary carboxylic acid amides |
|---|
| Substituents | carbonyl groupn-acetylarylaminen-arylamidecarboxylic acid derivativeorganohalogen compoundiodobenzeneorganoiodideorganic oxideorganonitrogen compoundorganopnictogen compoundacetamideorganic sulfuric acid or derivativescarboxamide grouparyl halidearomatic homomonocyclic compoundsecondary carboxylic acid amideorganic oxygen compoundhydrocarbon derivativearyl iodideorganic nitrogen compoundhalobenzenephenoxy compoundm-haloacetanilideorganooxygen compound |
|---|