| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 15:10:28 UTC |
|---|
| Update Date | 2025-03-25 00:57:33 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02225443 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C13H14O6 |
|---|
| Molecular Mass | 266.079 |
|---|
| SMILES | CC(=O)OCOC(=O)C(OC(C)=O)c1ccccc1 |
|---|
| InChI Key | VSNQZZIGXANEHM-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | benzenoids |
|---|
| Class | benzene and substituted derivatives |
|---|
| Subclass | benzyloxycarbonyls |
|---|
| Direct Parent | benzyloxycarbonyls |
|---|
| Geometric Descriptor | aromatic homomonocyclic compounds |
|---|
| Alternative Parents | acetalsacylalscarbonyl compoundshydrocarbon derivativesorganic oxidestricarboxylic acids and derivatives |
|---|
| Substituents | benzyloxycarbonylcarbonyl grouptricarboxylic acid or derivativescarboxylic acid derivativearomatic homomonocyclic compoundacylalorganic oxideorganic oxygen compoundacetalcarboxylic acid esterhydrocarbon derivativeorganooxygen compound |
|---|