| Record Information |
|---|
| HMDB Status | expected |
|---|
| Creation Date | 2024-02-21 15:10:29 UTC |
|---|
| Update Date | 2025-03-25 00:57:32 UTC |
|---|
| HMDB ID | HMDB0041812 |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02225482 |
|---|
| Name | 6-Acetylmorphine |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C19H21NO4 |
|---|
| Molecular Mass | 327.1471 |
|---|
| SMILES | CC(=O)OC1C=CC2C3Cc4ccc(O)c5c4C2(CCN3C)C1O5 |
|---|
| InChI Key | JJGYGPZNTOPXGV-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | alkaloids and derivatives |
|---|
| Class | morphinans |
|---|
| Subclass | morphinans |
|---|
| Direct Parent | morphinans |
|---|
| Geometric Descriptor | aromatic heteropolycyclic compounds |
|---|
| Alternative Parents | 1-hydroxy-2-unsubstituted benzenoidsalkyl aryl ethersamino acids and derivativesazacyclic compoundscarbonyl compoundscarboxylic acid esterscoumaranshydrocarbon derivativesmonocarboxylic acids and derivativesorganic oxidesorganopnictogen compoundsoxacyclic compoundsphenanthrenes and derivativespiperidinestetralinstrialkylamines |
|---|
| Substituents | tetralincarbonyl groupetheramino acid or derivatives1-hydroxy-2-unsubstituted benzenoidalkyl aryl ethercarboxylic acid derivativeorganic oxidearomatic heteropolycyclic compoundorganonitrogen compoundorganopnictogen compoundpiperidinetertiary amineorganoheterocyclic compoundcoumaranphenanthreneazacycletertiary aliphatic amineoxacyclemonocarboxylic acid or derivativesorganic oxygen compoundcarboxylic acid esterhydrocarbon derivativebenzenoidorganic nitrogen compoundmorphinanamineorganooxygen compound |
|---|
