| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 15:10:34 UTC |
|---|
| Update Date | 2025-03-25 00:57:34 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02225675 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C6H7F5O3 |
|---|
| Molecular Mass | 222.0315 |
|---|
| SMILES | CC(C)(OC(F)(F)C(F)(F)F)C(=O)O |
|---|
| InChI Key | DNJSHXNEINLKOY-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic acids and derivatives |
|---|
| Class | carboxylic acids and derivatives |
|---|
| Subclass | carboxylic acids |
|---|
| Direct Parent | carboxylic acids |
|---|
| Geometric Descriptor | aliphatic acyclic compounds |
|---|
| Alternative Parents | alkyl fluoridescarbonyl compoundsdialkyl ethershydrocarbon derivativesmonocarboxylic acids and derivativesorganic oxidesorganofluorides |
|---|
| Substituents | aliphatic acyclic compoundcarbonyl groupethercarboxylic acidalkyl fluorideorganofluorideorganohalogen compounddialkyl etherorganic oxidemonocarboxylic acid or derivativesorganic oxygen compoundalkyl halidehydrocarbon derivativeorganooxygen compound |
|---|
