| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 15:10:42 UTC |
|---|
| Update Date | 2025-03-25 00:57:37 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02225938 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C12H14N2O2 |
|---|
| Molecular Mass | 218.1055 |
|---|
| SMILES | CC(=O)NCCC1=CNc2ccc(O)c1c2 |
|---|
| InChI Key | JCLKKTIZTBOVRH-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic nitrogen compounds |
|---|
| Class | organonitrogen compounds |
|---|
| Subclass | amines |
|---|
| Direct Parent | secondary alkylarylamines |
|---|
| Geometric Descriptor | aromatic heteropolycyclic compounds |
|---|
| Alternative Parents | 1-hydroxy-2-unsubstituted benzenoidsacetamidesamino acids and derivativesazacyclic compoundsbenzenoidscarbonyl compoundscarboxylic acids and derivativeshydrocarbon derivativesorganic oxidesorganopnictogen compoundssecondary carboxylic acid amides |
|---|
| Substituents | carbonyl groupazacycleamino acid or derivatives1-hydroxy-2-unsubstituted benzenoidcarboxamide groupcarboxylic acid derivativesecondary aliphatic/aromatic aminesecondary carboxylic acid amideorganic oxideorganic oxygen compoundaromatic heteropolycyclic compoundorganopnictogen compoundhydrocarbon derivativebenzenoidorganoheterocyclic compoundacetamideorganooxygen compound |
|---|