| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 15:10:42 UTC |
|---|
| Update Date | 2025-03-25 00:57:37 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02225953 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C15H21Cl2N3O |
|---|
| Molecular Mass | 329.1062 |
|---|
| SMILES | CC(=O)NCCCN1CCN(c2cccc(Cl)c2Cl)CC1 |
|---|
| InChI Key | QFAZLAVMOGLTGR-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organoheterocyclic compounds |
|---|
| Class | diazinanes |
|---|
| Subclass | piperazines |
|---|
| Direct Parent | phenylpiperazines |
|---|
| Geometric Descriptor | aromatic heteromonocyclic compounds |
|---|
| Alternative Parents | acetamidesamino acids and derivativesaniline and substituted anilinesaryl chloridesazacyclic compoundscarbonyl compoundscarboxylic acids and derivativesdialkylarylaminesdichlorobenzeneshydrocarbon derivativesn-alkylpiperazinesn-arylpiperazinesorganic oxidesorganochloridesorganopnictogen compoundssecondary carboxylic acid amidestrialkylamines |
|---|
| Substituents | monocyclic benzene moietycarbonyl grouparomatic heteromonocyclic compoundamino acid or derivativesorganochloridecarboxylic acid derivativeorganohalogen compoundorganic oxidetertiary aliphatic/aromatic amineorganonitrogen compoundorganopnictogen compound1,2-dichlorobenzenedialkylarylaminetertiary amineacetamidearyl chloridechlorobenzeneazacycleaniline or substituted anilinesn-alkylpiperazinetertiary aliphatic aminecarboxamide grouparyl halidephenylpiperazinesecondary carboxylic acid amideorganic oxygen compoundhydrocarbon derivativebenzenoidorganic nitrogen compoundhalobenzeneaminen-arylpiperazineorganooxygen compound |
|---|
