| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 15:10:44 UTC |
|---|
| Update Date | 2025-03-25 00:57:38 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02226028 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C12H10N2O3 |
|---|
| Molecular Mass | 230.0691 |
|---|
| SMILES | CC(=O)Nc1c(Nc2ccccc2)c(=O)c1=O |
|---|
| InChI Key | JIOGCZUFEATMLD-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic nitrogen compounds |
|---|
| Class | organonitrogen compounds |
|---|
| Subclass | n-arylamides |
|---|
| Direct Parent | n-acetylarylamines |
|---|
| Geometric Descriptor | aromatic homomonocyclic compounds |
|---|
| Alternative Parents | acetamidesamino acids and derivativesbenzene and substituted derivativescarbonyl compoundscarboxylic acids and derivativescyclic ketoneshydrocarbon derivativesorganic oxidesorganopnictogen compoundssecondary aminessecondary carboxylic acid amidesvinylogous amides |
|---|
| Substituents | vinylogous amidemonocyclic benzene moietycarbonyl groupn-acetylarylamineamino acid or derivativescyclic ketonesecondary aminecarboxamide groupcarboxylic acid derivativearomatic homomonocyclic compoundsecondary carboxylic acid amideorganic oxideorganic oxygen compoundorganopnictogen compoundhydrocarbon derivativebenzenoidacetamideorganooxygen compoundamine |
|---|
