| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 15:10:44 UTC |
|---|
| Update Date | 2025-03-25 00:57:38 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02226036 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C16H24N2O6 |
|---|
| Molecular Mass | 340.1634 |
|---|
| SMILES | CC(=O)Nc1ccc(OC2OC(CO)C(O)C(O)C2N(C)C)cc1 |
|---|
| InChI Key | DFKJECMLRLZNIY-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic oxygen compounds |
|---|
| Class | organooxygen compounds |
|---|
| Subclass | carbohydrates and carbohydrate conjugates |
|---|
| Direct Parent | aminoglycosides |
|---|
| Geometric Descriptor | aromatic heteromonocyclic compounds |
|---|
| Alternative Parents | 1,2-aminoalcoholsacetalsacetamidesacetanilidesamino acids and derivativescarbonyl compoundscarboxylic acids and derivativeshydrocarbon derivativesmonosaccharidesn-acetylarylaminesorganic oxidesorganopnictogen compoundsoxacyclic compoundsoxanesphenol ethersphenoxy compoundsprimary alcoholssecondary alcoholssecondary carboxylic acid amidestrialkylamines |
|---|
| Substituents | phenol ethermonocyclic benzene moietycarbonyl groupn-acetylarylaminearomatic heteromonocyclic compoundamino acid or derivativesmonosacchariden-arylamidecarboxylic acid derivativeorganic oxideacetalorganonitrogen compoundaminoglycoside coreorganopnictogen compoundoxaneprimary alcoholtertiary amineorganoheterocyclic compoundacetamidealcoholacetanilide1,2-aminoalcoholtertiary aliphatic aminecarboxamide groupanilideoxacyclesecondary carboxylic acid amidesecondary alcoholhydrocarbon derivativebenzenoidorganic nitrogen compoundphenoxy compoundamine |
|---|
