| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 15:10:48 UTC |
|---|
| Update Date | 2025-03-25 00:57:39 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02226168 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C12H13Cl2NO2 |
|---|
| Molecular Mass | 273.0323 |
|---|
| SMILES | CC(=O)NC1CCOC1c1ccc(Cl)c(Cl)c1 |
|---|
| InChI Key | RFUYWUZNMOFRRD-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | benzenoids |
|---|
| Class | benzene and substituted derivatives |
|---|
| Subclass | halobenzenes |
|---|
| Direct Parent | dichlorobenzenes |
|---|
| Geometric Descriptor | aromatic heteromonocyclic compounds |
|---|
| Alternative Parents | acetamidesaryl chloridescarbonyl compoundscarboxylic acids and derivativesdialkyl ethershydrocarbon derivativesorganic oxidesorganochloridesorganonitrogen compoundsorganopnictogen compoundsoxacyclic compoundssecondary carboxylic acid amidestetrahydrofurans |
|---|
| Substituents | carbonyl groupetheraromatic heteromonocyclic compoundorganochloridecarboxylic acid derivativeorganohalogen compounddialkyl etherorganic oxideorganonitrogen compoundorganopnictogen compound1,2-dichlorobenzeneorganoheterocyclic compoundacetamidearyl chloridetetrahydrofurancarboxamide grouparyl halideoxacyclesecondary carboxylic acid amideorganic oxygen compoundhydrocarbon derivativeorganic nitrogen compoundorganooxygen compound |
|---|
