| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 15:10:50 UTC |
|---|
| Update Date | 2025-03-25 00:57:40 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02226238 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C14H20N2O |
|---|
| Molecular Mass | 232.1576 |
|---|
| SMILES | CC(NC(=O)Cc1ccccc1)C1CCCN1 |
|---|
| InChI Key | OUNVFSXKLKRBSV-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | benzenoids |
|---|
| Class | benzene and substituted derivatives |
|---|
| Subclass | phenylacetamides |
|---|
| Direct Parent | phenylacetamides |
|---|
| Geometric Descriptor | aromatic heteromonocyclic compounds |
|---|
| Alternative Parents | amino acids and derivativesazacyclic compoundscarbonyl compoundscarboxylic acids and derivativesdialkylamineshydrocarbon derivativesorganic oxidesorganopnictogen compoundspyrrolidinessecondary carboxylic acid amides |
|---|
| Substituents | secondary aliphatic aminecarbonyl grouparomatic heteromonocyclic compoundazacycleamino acid or derivativessecondary aminecarboxamide groupcarboxylic acid derivativesecondary carboxylic acid amideorganic oxideorganic oxygen compoundorganonitrogen compoundorganopnictogen compoundhydrocarbon derivativeorganic nitrogen compoundpyrrolidinephenylacetamideorganoheterocyclic compoundorganooxygen compoundamine |
|---|
