| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 15:10:52 UTC |
|---|
| Update Date | 2025-03-25 00:57:41 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02226326 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C11H15N5O4 |
|---|
| Molecular Mass | 281.1124 |
|---|
| SMILES | CC(O)C(=O)C1N=c2c(=O)nc(N)[nH]c2=NC1C(C)O |
|---|
| InChI Key | HCWZGAQNJLBNGR-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organoheterocyclic compounds |
|---|
| Class | pteridines and derivatives |
|---|
| Subclass | pterins and derivatives |
|---|
| Direct Parent | pterins and derivatives |
|---|
| Geometric Descriptor | aromatic heteropolycyclic compounds |
|---|
| Alternative Parents | acyloinsazacyclic compoundsheteroaromatic compoundshydrocarbon derivativesimidolactamsketonesorganic oxidesorganopnictogen compoundsprimary aminespyrimidonessecondary alcoholsvinylogous amides |
|---|
| Substituents | carbonyl grouppyrimidonepyrimidineketoneorganic oxidearomatic heteropolycyclic compoundorganonitrogen compoundorganopnictogen compoundimidolactamalcoholvinylogous amidepterinazacycleheteroaromatic compoundorganic oxygen compoundacyloinsecondary alcoholhydrocarbon derivativeprimary amineorganic nitrogen compoundamineorganooxygen compound |
|---|
