| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 15:10:53 UTC |
|---|
| Update Date | 2025-03-25 00:57:41 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02226360 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C5H10NO7P |
|---|
| Molecular Mass | 227.0195 |
|---|
| SMILES | CC(O)C(=O)NCC(=O)OP(=O)(O)O |
|---|
| InChI Key | VZHHDNSTODZVMX-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic acids and derivatives |
|---|
| Class | carboxylic acids and derivatives |
|---|
| Subclass | amino acids, peptides, and analogues |
|---|
| Direct Parent | acyl glycines |
|---|
| Geometric Descriptor | aliphatic acyclic compounds |
|---|
| Alternative Parents | acyl monophosphatesalpha amino acidscarbonyl compoundshydrocarbon derivativesmonocarboxylic acids and derivativesorganic oxidesorganic phosphoric acids and derivativesorganonitrogen compoundsorganopnictogen compoundsphosphoethanolaminessecondary alcoholssecondary carboxylic acid amides |
|---|
| Substituents | aliphatic acyclic compoundcarbonyl groupphosphoethanolamineorganic oxideorganonitrogen compoundalpha-amino acidorganopnictogen compoundalcoholacyl monophosphatecarboxamide groupn-acylglycinesecondary carboxylic acid amidemonocarboxylic acid or derivativesorganic oxygen compoundsecondary alcoholhydrocarbon derivativeorganic nitrogen compoundorganic phosphoric acid derivativeorganooxygen compoundacyl phosphate |
|---|
