| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 15:10:53 UTC |
|---|
| Update Date | 2025-03-25 00:57:42 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02226369 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C19H24O10 |
|---|
| Molecular Mass | 412.1369 |
|---|
| SMILES | CC(Cc1ccc(C(C)C(=O)OC2C(C(=O)O)OC(O)C(O)C2O)cc1)C(=O)O |
|---|
| InChI Key | MOOWAKYYJXMLSN-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic oxygen compounds |
|---|
| Class | organooxygen compounds |
|---|
| Subclass | carbohydrates and carbohydrate conjugates |
|---|
| Direct Parent | glucuronic acid derivatives |
|---|
| Geometric Descriptor | aromatic heteromonocyclic compounds |
|---|
| Alternative Parents | 1,2-diolsaromatic monoterpenoidscarbonyl compoundscarboxylic acid esterscarboxylic acidshemiacetalshydrocarbon derivativesmonocyclic monoterpenoidsmonosaccharidesorganic oxidesoxacyclic compoundsoxanesphenylpropanesphenylpropanoic acidspyran carboxylic acidssecondary alcoholstricarboxylic acids and derivatives |
|---|
| Substituents | monoterpenoidmonocyclic benzene moietycarbonyl groupmonocyclic monoterpenoidcarboxylic acidglucuronic acid or derivativesaromatic heteromonocyclic compound3-phenylpropanoic-acidmonosaccharidetricarboxylic acid or derivativesp-cymenecarboxylic acid derivativepyran carboxylic acidphenylpropaneorganic oxidehemiacetaloxaneorganoheterocyclic compound1,2-diolalcoholpyran carboxylic acid or derivativesoxacyclepyrancarboxylic acid estersecondary alcoholhydrocarbon derivativebenzenoidaromatic monoterpenoid |
|---|
