| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 15:10:58 UTC |
|---|
| Update Date | 2025-03-25 00:57:44 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02226546 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C22H34O6 |
|---|
| Molecular Mass | 394.2355 |
|---|
| SMILES | CC1(C(=O)O)CCCC2(C)C3C(O)CC4(C)C(CCC4(O)C(=O)O)C3CCC12 |
|---|
| InChI Key | CHBXAWMNMWOOIK-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | lipids and lipid-like molecules |
|---|
| Class | steroids and steroid derivatives |
|---|
| Subclass | hydroxysteroids |
|---|
| Direct Parent | 17-hydroxysteroids |
|---|
| Geometric Descriptor | aliphatic homopolycyclic compounds |
|---|
| Alternative Parents | 11-hydroxysteroidsalpha hydroxy acids and derivativesandrostane steroidscarbonyl compoundscarboxylic acidscyclic alcohols and derivativesdicarboxylic acids and derivativeshydrocarbon derivativesorganic oxidessecondary alcoholstertiary alcohols |
|---|
| Substituents | alcoholcarbonyl groupcarboxylic acidalpha-hydroxy acidhydroxy acidcyclic alcoholcarboxylic acid derivativealiphatic homopolycyclic compoundtertiary alcoholorganic oxideorganic oxygen compoundandrostane-skeletonsecondary alcoholdicarboxylic acid or derivativeshydrocarbon derivative11-hydroxysteroidorganooxygen compound17-hydroxysteroid |
|---|
