| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 15:10:59 UTC |
|---|
| Update Date | 2025-03-25 00:57:44 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02226585 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C9H18O14P2 |
|---|
| Molecular Mass | 412.0172 |
|---|
| SMILES | CC(OC1C(O)C(OP(=O)(O)O)C(O)C(O)C1OP(=O)(O)O)C(=O)O |
|---|
| InChI Key | QUYIWSZXKQDUKU-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic oxygen compounds |
|---|
| Class | organooxygen compounds |
|---|
| Subclass | alcohols and polyols |
|---|
| Direct Parent | inositol phosphates |
|---|
| Geometric Descriptor | aliphatic homomonocyclic compounds |
|---|
| Alternative Parents | carbonyl compoundscarboxylic acidscyclohexanolsdialkyl ethershydrocarbon derivativesmonoalkyl phosphatesmonocarboxylic acids and derivativesorganic oxides |
|---|
| Substituents | carbonyl groupethercarboxylic acidcyclohexanolinositol phosphatecarboxylic acid derivativedialkyl etherorganic oxidemonocarboxylic acid or derivativesphosphoric acid estermonoalkyl phosphatesecondary alcoholaliphatic homomonocyclic compoundhydrocarbon derivativeorganic phosphoric acid derivativealkyl phosphate |
|---|
