| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 15:11:00 UTC |
|---|
| Update Date | 2025-03-25 00:57:45 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02226620 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C18H18O3 |
|---|
| Molecular Mass | 282.1256 |
|---|
| SMILES | CC1(C)CC(c2ccc(O)cc2)=C(c2ccc(O)cc2)O1 |
|---|
| InChI Key | CFUMPZQFFAQPKT-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | phenylpropanoids and polyketides |
|---|
| Class | stilbenes |
|---|
| Subclass | stilbenes |
|---|
| Direct Parent | stilbenes |
|---|
| Geometric Descriptor | aromatic heteromonocyclic compounds |
|---|
| Alternative Parents | 1-hydroxy-2-unsubstituted benzenoidsbenzene and substituted derivativesdihydrofuranshydrocarbon derivativesorganooxygen compoundsoxacyclic compounds |
|---|
| Substituents | monocyclic benzene moietyaromatic heteromonocyclic compound1-hydroxy-2-unsubstituted benzenoidoxacycleorganic oxygen compoundphenolhydrocarbon derivativebenzenoidorganoheterocyclic compoundorganooxygen compounddihydrofuranstilbene |
|---|