| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 15:11:02 UTC |
|---|
| Update Date | 2025-03-25 00:57:46 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02226709 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C9H14N4O4 |
|---|
| Molecular Mass | 242.1015 |
|---|
| SMILES | CC(O)C(O)C1CNn2c(cc(=O)[nH]c2=O)N1 |
|---|
| InChI Key | GLVGPHWAFJFJMI-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organoheterocyclic compounds |
|---|
| Class | diazines |
|---|
| Subclass | pyrimidines and pyrimidine derivatives |
|---|
| Direct Parent | pyrimidones |
|---|
| Geometric Descriptor | aromatic heteropolycyclic compounds |
|---|
| Alternative Parents | 1,2,4-triazines1,2-diolsazacyclic compoundsheteroaromatic compoundshydrocarbon derivativeslactamsorganic carbonic acids and derivativesorganic oxidesorganopnictogen compoundssecondary alcoholssecondary alkylarylaminesvinylogous amides |
|---|
| Substituents | lactampyrimidoneorganic oxidearomatic heteropolycyclic compoundorganonitrogen compoundorganopnictogen compound1,2-diolalcoholvinylogous amidecarbonic acid derivativeazacycleheteroaromatic compoundsecondary aminesecondary aliphatic/aromatic amineorganic oxygen compoundsecondary alcoholtriazinehydrocarbon derivativeorganic nitrogen compound1,2,4-triazineorganooxygen compoundamine |
|---|
