| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 15:11:05 UTC |
|---|
| Update Date | 2025-03-25 00:57:47 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02226812 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C6H15N3O3S |
|---|
| Molecular Mass | 209.0834 |
|---|
| SMILES | CC(C)CC(O)C(N)=NS(N)(=O)=O |
|---|
| InChI Key | YEORPCPFQQGJIM-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic acids and derivatives |
|---|
| Class | organic sulfuric acids and derivatives |
|---|
| Subclass | organic sulfuric acids and derivatives |
|---|
| Direct Parent | organic sulfuric acids and derivatives |
|---|
| Geometric Descriptor | aliphatic acyclic compounds |
|---|
| Alternative Parents | amidineshydrocarbon derivativesorganic oxidesorganopnictogen compoundssecondary alcohols |
|---|
| Substituents | alcoholaliphatic acyclic compoundorganic sulfuric acid or derivativesamidineorganic oxideorganic oxygen compoundorganonitrogen compoundsecondary alcoholorganopnictogen compoundhydrocarbon derivativeorganic nitrogen compoundorganooxygen compound |
|---|
