| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 15:11:07 UTC |
|---|
| Update Date | 2025-03-25 00:57:48 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02226873 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C12H24N4O2 |
|---|
| Molecular Mass | 256.1899 |
|---|
| SMILES | CC(C)CC1CN(CCCC(N)C(=O)O)C(=N)N1 |
|---|
| InChI Key | WTSPHIHMYAUMFL-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic acids and derivatives |
|---|
| Class | carboxylic acids and derivatives |
|---|
| Subclass | amino acids, peptides, and analogues |
|---|
| Direct Parent | arginine and derivatives |
|---|
| Geometric Descriptor | aliphatic heteromonocyclic compounds |
|---|
| Alternative Parents | alpha amino acidsazacyclic compoundsbranched fatty acidscarbonyl compoundscarboximidamidescarboxylic acidsguanidinesheterocyclic fatty acidshydrocarbon derivativesimidazolidinesiminesmonoalkylaminesmonocarboxylic acids and derivativesorganic oxidesorganopnictogen compounds |
|---|
| Substituents | imidazolidinefatty acylcarbonyl groupcarboxylic acidheterocyclic fatty acidguanidineiminefatty acidorganic oxidearginine or derivativesaliphatic heteromonocyclic compoundorganonitrogen compoundalpha-amino acidorganopnictogen compoundorganoheterocyclic compoundazacyclecarboximidamidebranched fatty acidmonocarboxylic acid or derivativesorganic oxygen compoundhydrocarbon derivativeprimary aliphatic amineorganic nitrogen compoundorganooxygen compound |
|---|